[6,6]-Thienyl C61 butyric acid methyl ester
Molecular Weight | 916.91 |
Canonical SMILES | COC(=O)CCCC2(c1cccs1)[C]3=4c5c6c7c8c9c%10c(c%11c%12c3c%13c5c%14c%15c6c%16c7c%17c9c%18c%19c%10c%20c%11c%21c%12c%22c%13c%23c%14c%24c%15c%25c%16c%26c%17c%18c%27c%28c%19c%20c%29c%21c%30c%22c%23c%31c%24c%32c%25c%26c%27c%33c%28c%29c%30c%31c%32%33)[C]2=48 |
Solubility | organic solvents: soluble |
Application | [6,6]-Thienyl C61 butyric acid methyl ester is a class of thienyl based PCBM that can be used for the fabrication of optoelectronic devices such as organic solar cells (OSCs). |
Storage | room temp |
Assay | ≥99% |
NACRES | NA.23 |
Packaging | 100 mg in glass insert |
Quality Level | 100 |