[6,6]-Pentadeuterophenyl C61 butyric acid methyl ester
Catalog Number
ACM749898804-1
Synonyms
1-[3-(Methoxycarbonyl)propyl]-1-pentadeuterophenyl-[6.6] C61,d5-PCBM
| Description | [6,6]-Pentadeuterophenyl C61 butyric acid methyl ester (PC60BM) is a deuterated fullerene that can be used as an acceptor molecule. It has a fullerene as the core and deuterium and benzyl as the attachment. The deuterium atoms facilitate an increase in the quantum efficiency of the electrochemical devices. |
| Molecular Weight | 915.91 |
| Canonical SMILES | [2H]c1c([2H])c([2H])c(c([2H])c1[2H])C2(CCCC(=O)OC)[C]3=4c5c6c7c8c9c%10c(c%11c%12c3c%13c5c%14c%15c6c%16c7c%17c9c%18c%19c%10c%20c%11c%21c%12c%22c%13c%23c%14c%24c%15c%25c%16c%26c%17c%18c%27c%28c%19c%20c%29c%21c%30c%22c%23c%31c%24c%32c%25c%26c%27c%33c%28c%29c%30c%31c%32%33)[C]2=48 |
| Application | PC60BM is a conjugating polymer that can be used as an alternative to the conventionally used PCBM for the organic electronic based applications, which include polymeric solar cells and organic light emitting diodes (OLEDs). |
| Storage | room temp |
| Assay | 0.995 |
| NACRES | NA.23 |
| Packaging | 100 mg in glass insert |
| Quality Level | 100 |