| IUPAC Name | 5-octylthieno[3,4-c]pyrrole-4,6-dione |
|---|---|
| Molecular Weight | 265.37 |
| Molecular Formula | C14H19NO2S |
| Canonical SMILES | CCCCCCCCN1C(=O)c2cscc2C1=O |
| InChI | 1S/C14H19NO2S/c1-2-3-4-5-6-7-8-15-13(16)11-9-18-10-12(11)14(15)17/h9-10H,2-8H2,1H3 |
| InChI Key | QMNVUZQWXKLEFP-UHFFFAOYSA-N |
| Melting Point | 119-126 °C |
| Purity | ≥ 97% |
| Application | Monomer for synthesis of polymers for high power conversion efficiency (PCE) organic solar cells and OFETs through direct arylation polycondensation. Inverted bulk heterojunction solar cells based on PolyDTS-TPD:PC70BM blends or PolyDTG-TPD:PC70BM blends achieved average power conversion efficiencies of from 6.6 - 7.3%. (DTS: dithienosilole; DTG: dithienogermole; TPD: thienopyrrolodione) |
| Storage | room temp |
| Assay | 98% |
| Form | powder or crystals |
| MDL Number | MFCD23703118 |
| NACRES | NA.23 |
| Packaging | Packaging 1 g in glass bottle |
| Quality Level | 100 |