The Best Industrial
Solution Provider
Certified Company
ISO 9001:2015 Certification
Solution Provider
ISO 9001:2015 Certification
| IUPAC Name | [(1R,2S,3R,4S)-3-(hydroxymethyl)-2-bicyclo[2.2.1]hept-5-enyl]methanol |
|---|---|
| Molecular Weight | 154.21 |
| Molecular Formula | C9H14O2 |
| Canonical SMILES | OC[C@@H]1[C@H]2C[C@H](C=C2)[C@@H]1CO |
| InChI | 1S/C9H14O2/c10-4-8-6-1-2-7(3-6)9(8)5-11/h1-2,6-11H,3-5H2/t6-,7+,8-,9+ |
| InChI Key | IGHHPVIMEQGKNE-SPJNRGJMSA-N |
| Boiling Point | 130ºC / 1mmHg |
| Melting Point | 82-86 °C (lit.) |
| Flash Point | 122.714ºC |
| Purity | 96% |
| Density | 1.137g/mL |
| Storage | room temp |
| Assay | 98% |
| Fluorescence | 1S/C9H14O2/c10-4-8-6-1-2-7(3-6)9(8)5-11/h1-2,6-11H,3-5H2/t6-,7+,8-,9+ |
| MDL Number | MFCD00674044 |
| Packaging | 5 g in glass bottle |
| Quality Level | 100 |
![3-Oxabicyclo[3.1.0]hexane-2,4-dione](https://resource.alfa-chemistry.com/structure/5617-74-3.gif)
![1,1,3,3-Tetramethyl-1,3-Bis[2-(5-Norbornen-2-yl)Ethyl]Disiloxane, Mixture of Endo and Exo](https://resource.alfa-chemistry.com/structure/198570-39-7.gif)
