The Best Industrial
Solution Provider
Certified Company
ISO 9001:2015 Certification
Solution Provider
ISO 9001:2015 Certification
| IUPAC Name | [2-(hydroxymethyl)-2-bicyclo[2.2.1]hept-5-enyl]methanol |
|---|---|
| Molecular Weight | 154.21g/mol |
| Molecular Formula | C9H14O2 |
| Canonical SMILES | OCC1(CO)C[C@@H]2C[C@H]1C=C2 |
| InChI | 1S/C9H14O2/c10-5-9(6-11)4-7-1-2-8(9)3-7/h1-2,7-8,10-11H,3-6H2/t7-,8+/m0/s1 |
| InChI Key | DSHXMENPUICESR-JGVFFNPUSA-N |
| Melting Point | 111-113 °C (lit.) |
| Storage | room temp |
| Assay | 98% |
| Fluorescence | 1S/C9H14O2/c10-5-9(6-11)4-7-1-2-8(9)3-7/h1-2,7-8,10-11H,3-6H2/t7-,8+/m0/s1 |
| MDL Number | MFCD00167595 |
| Packaging | 1 g in glass bottle |
| Quality Level | 100 |
rhodium(I) hexafluorophosphate](https://resource.alfa-chemistry.com/structure/32761-50-5.gif)
![3-Oxabicyclo[3.1.0]hexane-2,4-dione](https://resource.alfa-chemistry.com/structure/5617-74-3.gif)
![1,1,3,3-Tetramethyl-1,3-Bis[2-(5-Norbornen-2-yl)Ethyl]Disiloxane, Mixture of Endo and Exo](https://resource.alfa-chemistry.com/structure/198570-39-7.gif)