The Best Industrial
Solution Provider
Certified Company
ISO 9001:2015 Certification
Solution Provider
ISO 9001:2015 Certification
| IUPAC Name | 4-Bromo-N-(4-bromophenyl)-N-phenylaniline |
|---|---|
| Molecular Weight | 403.1 |
| Molecular Formula | C18H13Br2N |
| Canonical SMILES | C1=CC=C(C=C1)N(C2=CC=C(C=C2)Br)C3=CC=C(C=C3)Br |
| InChI | InChI=1S/C18H13Br2N/c19-14-6-10-17(11-7-14)21(16-4-2-1-3-5-16)18-12-8-15(20)9-13-18/h1-13H |
| InChI Key | KIGVOJUDEQXKII-UHFFFAOYSA-N |
| Boiling Point | 470.7±30.0 °C/760mmHg (lit.) |
| Melting Point | 69 °C |
| Flash Point | 110 °C |
| Purity | 95%+ |
| Density | 1.6±0.1 g/cm³ |
| Appearance | Off-white solid |
| Application | Polytriarylamine Semiconductors Hole transport material and building block for hole transport materials. |
| Storage | Inert atmosphere,Room Temperature |
| Assay | 96% |
| MDL Number | MFCD00060104 |
| NACRES | NA.23 |
| Packaging | Packaging 1, 5 g in glass bottle |
| Quality Level | 100 |
| Refractive Index | n20/D 1.679 (lit.) |
