4-(2,3-Dihydro-1,3-dimethyl-1H-benzimidazol-2-yl)-N,N-dimethylbenzenamine
Catalog Number
ACM302818731
Synonyms
4-(1,3-Dimethyl-2,3-dihydro-1H-benzoimidazol-2-yl)phenyl)dimethylamine,N-DMBI
| Description | 4-(2,3-Dihydro-1,3-dimethyl-1H-benzimidazol-2-yl)-N,N-dimethylbenzenamine is a semiconducting organic molecule with a π-conjugated polycyclic system. It is a strong electron donor molecule that can be used for n-type doping. It shows conductivity of ~2 × 10−3 S/cm as a dopant. It also acts as a reagent for the reductive transformation of organic compounds. |
| IUPAC Name | 4-(1,3-dimethyl-2H-benzimidazol-2-yl)-N,N-dimethylaniline |
| Molecular Weight | 267.37 |
| Molecular Formula | C17H21N3 |
| Canonical SMILES | CN(C)c1ccc(cc1)C2N(C)c3ccccc3N2C |
| InChI | 1S/C17H21N3/c1-18(2)14-11-9-13(10-12-14)17-19(3)15-7-5-6-8-16(15)20(17)4/h5-12,17H,1-4H3,AKIIMLCQTGCWQQ-UHFFFAOYSA-N |
| InChI Key | AKIIMLCQTGCWQQ-UHFFFAOYSA-N |
| Melting Point | 105-110 °C |
| Purity | 98% |
| Appearance | Light orange powder |
| Application | Air stable n-type dopant for n-channel Organic Thin Film Transistors (OTFTs) and solar cells (OPVs). |
| Storage | room temp |
| Assay | 98% (HPLC) |
| MDL Number | MFCD00222361 |
| Packaging | 1 g in glass bottle |
| Quality Level | 100 |