The Best Industrial
Solution Provider
Certified Company
ISO 9001:2015 Certification
Solution Provider
ISO 9001:2015 Certification
| IUPAC Name | 3-(4-tert-butylphenyl)-4-phenyl-5-(4-phenylphenyl)-1,2,4-triazole |
|---|---|
| Molecular Weight | 429.56 |
| Molecular Formula | C30H27N3 |
| Canonical SMILES | CC(C)(C)c1ccc(cc1)-c2cc(cc(c2)-c3nc[nH]n3)-c4ccc(cc4)-c5ccccc5 |
| InChI | 1S/C30H27N3/c1-30(2,3)26-20-18-25(19-21-26)29-32-31-28(33(29)27-12-8-5-9-13-27)24-16-14-23(15-17-24)22-10-6-4-7-11-22/h4-21H,1-3H3,ZVFQEOPUXVPSLB-UHFFFAOYSA-N |
| InChI Key | ZVFQEOPUXVPSLB-UHFFFAOYSA-N |
| Melting Point | 231-235 °C |
| Application | OLED and QD-LED electron transporter and hole blocker material. |
| Storage | room temp |
| Assay | 0.97 |
| Fluorescence | λex 280 nm; λem 372 nm in chloroform |
| Form | ITO/HMPD/TAZ:Ir(ppy)3 (7%)/Alq3/Al:Li• Color: green• Max. Luminance: 4000 Cd/m2• Max. EQE: 15 % |
| MDL Number | MFCD00799419 |
| Orbital Energy | HOMO 6.4 eV |
| Packaging | 1 g in glass bottle |
| Quality Level | 100 |