| Molecular Weight | 314.18 |
|---|---|
| Canonical SMILES | OC(/C(C#N)=C/C(S1)=CC2=C1C=C(Br)S2)=O |
| InChI | 1S/C10H4BrNO2S2/c11-9-3-8-7(16-9)2-6(15-8)1-5(4-12)10(13)14/h1-3H,(H,13,14)/b5-1+ |
| InChI Key | HCSMOQZFARKOTQ-ORCRQEGFSA-N |
| Melting Point | 267-275 °C |
| Purity | ≥ 97% |
| Application | This material can be used in the synthesis of Ruthenium-Free Dyes for Dye Sensitized Solar Cells similar to MK2 Dye (Aldrich Prod. No. 728705). |
| Storage | room temp |
| Assay | 97% (HPLC) |
| Form | powder or crystals |
| MDL Number | MFCD27665182 |
| NACRES | NA.23 |
| Packaging | Packaging 500 mg in glass insert |
| Quality Level | 100 |