| IUPAC Name | 5-thieno[3,2-b]thiophen-5-ylthieno[3,2-b]thiophene |
|---|---|
| Molecular Weight | 278.44 |
| Molecular Formula | C12H6S4 |
| Canonical SMILES | C1(C=C(C2=CC3=C(C=CS3)S2)S4)=C4C=CS1 |
| InChI | 1S/C12H6S4/c1-3-13-9-5-11(15-7(1)9)12-6-10-8(16-12)2-4-14-10/h1-6H |
| InChI Key | ZDFFDKMGCBNSKY-UHFFFAOYSA-N |
| Melting Point | 232-238 °C |
| Purity | ≥ 97% |
| Application | This material is used as a binary pi-conjugated spacer in the synthesis of highly efficient; stable dyes for dye-sensitized solar cells. |
| Storage | room temp |
| Assay | 96% |
| Form | powder or crystals |
| MDL Number | MFCD27665376 |
| NACRES | NA.23 |
| Packaging | Packaging 1 g in glass bottle |
| Quality Level | 100 |