IUPAC Name | 5-thieno[3,2-b]thiophen-5-ylthieno[3,2-b]thiophene |
---|---|
Molecular Weight | 278.44 |
Molecular Formula | C12H6S4 |
Canonical SMILES | C1(C=C(C2=CC3=C(C=CS3)S2)S4)=C4C=CS1 |
InChI | 1S/C12H6S4/c1-3-13-9-5-11(15-7(1)9)12-6-10-8(16-12)2-4-14-10/h1-6H |
InChI Key | ZDFFDKMGCBNSKY-UHFFFAOYSA-N |
Melting Point | 232-238 °C |
Purity | ≥ 97% |
Application | This material is used as a binary pi-conjugated spacer in the synthesis of highly efficient; stable dyes for dye-sensitized solar cells. |
Storage | room temp |
Assay | 96% |
Form | powder or crystals |
MDL Number | MFCD27665376 |
NACRES | NA.23 |
Packaging | Packaging 1 g in glass bottle |
Quality Level | 100 |