| Description | 1,3,5-Tris(4-bromophenyl)benzene (TBB) is a halogenated aromatic monomer that can be used in the formation of covalent aromatic frameworks(COF). |
|---|---|
| IUPAC Name | 1,3,5-tris(4-bromophenyl)benzene |
| Molecular Weight | 543.09 |
| Molecular Formula | C24H15Br3 |
| Canonical SMILES | Brc1ccc(cc1)-c2cc(cc(c2)-c3ccc(Br)cc3)-c4ccc(Br)cc4 |
| InChI | 1S/C24H15Br3/c25-22-7-1-16(2-8-22)19-13-20(17-3-9-23(26)10-4-17)15-21(14-19)18-5-11-24(27)12-6-18/h1-15H |
| InChI Key | HJQRITCAXSBOPC-UHFFFAOYSA-N |
| Boiling Point | 574.9ºC at 760mmHg |
| Melting Point | 261-265 °C |
| Flash Point | 289.1ºC |
| Purity | >98.0%(HPLC) |
| Density | 1.626g/cm3 |
| Appearance | White to Light yellow to Light orange powder to crystal |
| Application | TBB can be used to synthesize porous aromatic frameworks for the development of adsorption membranes to treat organic pollutants. It can also be used in the fabrication of pyridine based high efficiency organic light emitting diodes(OLEDs). |
| Storage | room temp |
| Assay | 97% |
| MDL Number | MFCD00362911 |
| NACRES | NA.23 |
| Packaging | Packaging 1, 5 g in glass bottle |
| Quality Level | 200 |