[(1,2-Diphenylethene-1,2-diyl)bis(4,1-phenylene)]diboronic acid
Description | Aggregation-induced emission luminogens (AIEgens) such as tetraphenylethene (TPE) functionalized with boronic acids form luminogen (TPE-BA). TPE-BA can form oligoboronates with D-glucose. Other sugars also form monoadduct with TPE-BA, but once such a complex is formed there is no more cis-diol that allows the oligomerization reaction to proceed, resulting in a very low emission intensity. Thus, TPE-BA could serve as a glucose-specific probe. |
IUPAC Name | [4-[(E)-2-(4-boronophenyl)-1,2-diphenylethenyl]phenyl]boronic acid |
Molecular Weight | 420.07 |
Molecular Formula | C26H22B2O4 |
Canonical SMILES | OB(O)C(C=C1)=CC=C1/C(C2=CC=CC=C2)=C(C3=CC=C(B(O)O)C=C3)\C4=CC=CC=C4 |
InChI | 1S/C26H22B2O4/c29-27(30)23-15-11-21(12-16-23)25(19-7-3-1-4-8-19)26(20-9-5-2-6-10-20)22-13-17-24(18-14-22)28(31)32/h1-18,29-32H/b26-25+,CFKHFTZRFSABDV-OCEACIFDSA-N |
InChI Key | CFKHFTZRFSABDV-OCEACIFDSA-N |
Melting Point | 2-8°C |
Application | TPE-BA is an aggregation-induced emission (AIE) dye for use in Suzuki reaction and D-Glucose detection. |
Storage | room temp |
Assay | 0.96 |
Form | solid |
Packaging | 25 mg in glass insert |
Quality Level | 100 |